C20H30O5 — CID 11681825
[(1S,2R,4aS,5S,8aR)-2-acetyl-5-hydroxy-4a-methyl-8-methylidene-1,2,3,4,5,6,7,8a-octahydronaphthalen-1-yl] (E)-4-hydroxy-4-methylpent-2-enoate (PubChem CID 11681825) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is [(1S,2R,4aS,5S,8aR)-2-acetyl-5-hydroxy-4a-methyl-8-methylidene-1,2,3,4,5,6,7,8a-octahydronaphthalen-1-yl] (E)-4-hydroxy-4-methylpent-2-enoate.
| Compound Name | [(1S,2R,4aS,5S,8aR)-2-acetyl-5-hydroxy-4a-methyl-8-methylidene-1,2,3,4,5,6,7,8a-octahydronaphthalen-1-yl] (E)-4-hydroxy-4-methylpent-2-enoate |
|---|---|
| PubChem CID | 11681825 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | [(1S,2R,4aS,5S,8aR)-2-acetyl-5-hydroxy-4a-methyl-8-methylidene-1,2,3,4,5,6,7,8a-octahydronaphthalen-1-yl] (E)-4-hydroxy-4-methylpent-2-enoate |
| SMILES | C=C1CC[C@H](O)[C@@]2(C)CC[C@@H](C(C)=O)[C@@H](OC(=O)/C=C/C(C)(C)O)[C@H]12 |
| InChI | InChI=1S/C20H30O5/c1-12-6-7-15(22)20(5)11-8-14(13(2)21)18(17(12)20)25-16(23)9-10-19(3,4)24/h9-10,14-15,17-18,22,24H,1,6-8,11H2,2-5H3/b10-9+/t14-,15-,17-,18+,20+/m0/s1 |
| InChIKey | WZTNCEBBCFHTOP-NQKIYUNRSA-N |
| XLogP | 2.56 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|