C16H34O6Si — CID 11681830
(1S,2R,3R,4R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-(methoxymethoxy)-4-(methoxymethyl)cyclohexane-1,2-diol (PubChem CID 11681830) has the molecular formula C16H34O6Si and a molecular weight of 350.53 g/mol. Its IUPAC name is (1S,2R,3R,4R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-(methoxymethoxy)-4-(methoxymethyl)cyclohexane-1,2-diol.
| Compound Name | (1S,2R,3R,4R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-(methoxymethoxy)-4-(methoxymethyl)cyclohexane-1,2-diol |
|---|---|
| PubChem CID | 11681830 |
| Molecular Formula | C16H34O6Si |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (1S,2R,3R,4R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-(methoxymethoxy)-4-(methoxymethyl)cyclohexane-1,2-diol |
| SMILES | COCO[C@@H]1C[C@H](COC)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H34O6Si/c1-16(2,3)23(6,7)22-15-11(9-19-4)8-12(21-10-20-5)13(17)14(15)18/h11-15,17-18H,8-10H2,1-7H3/t11-,12-,13-,14-,15-/m1/s1 |
| InChIKey | TUWURFBQZRWMKS-KJWHEZOQSA-N |
| XLogP | 1.75 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|