C11H14Br2O3 — CID 11681892
2,3-dibromo-1,5-dimethoxy-4-propan-2-yloxybenzene (PubChem CID 11681892) has the molecular formula C11H14Br2O3 and a molecular weight of 354.04 g/mol. Its IUPAC name is 2,3-dibromo-1,5-dimethoxy-4-propan-2-yloxybenzene.
| Compound Name | 2,3-dibromo-1,5-dimethoxy-4-propan-2-yloxybenzene |
|---|---|
| PubChem CID | 11681892 |
| Molecular Formula | C11H14Br2O3 |
| Molecular Weight | 354.04 g/mol |
| Exact Mass | 351.93 |
| IUPAC Name | 2,3-dibromo-1,5-dimethoxy-4-propan-2-yloxybenzene |
| SMILES | COc1cc(OC)c(OC(C)C)c(Br)c1Br |
| InChI | InChI=1S/C11H14Br2O3/c1-6(2)16-11-8(15-4)5-7(14-3)9(12)10(11)13/h5-6H,1-4H3 |
| InChIKey | HVRNGRKHSKSNMV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.04 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |