About 2-(4-bromo-1,5-dimethylpyrazol-3-yl)-2-methylpropanoic acid
2-(4-bromo-1,5-dimethylpyrazol-3-yl)-2-methylpropanoic acid (PubChem CID 116818937) has the molecular formula C9H13BrN2O2
and a molecular weight of 261.12 g/mol. Its IUPAC name is 2-(4-bromo-1,5-dimethylpyrazol-3-yl)-2-methylpropanoic acid.
Analyze 2-(4-bromo-1,5-dimethylpyrazol-3-yl)-2-methylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromo-1,5-dimethylpyrazol-3-yl)-2-methylpropanoic acid?
The IUPAC name of 2-(4-bromo-1,5-dimethylpyrazol-3-yl)-2-methylpropanoic acid (CID 116818937) is 2-(4-bromo-1,5-dimethylpyrazol-3-yl)-2-methylpropanoic acid.
What is the SMILES notation for 2-(4-bromo-1,5-dimethylpyrazol-3-yl)-2-methylpropanoic acid?
The canonical SMILES for 2-(4-bromo-1,5-dimethylpyrazol-3-yl)-2-methylpropanoic acid is Cc1c(Br)c(C(C)(C)C(=O)O)nn1C.
What is the InChIKey of 2-(4-bromo-1,5-dimethylpyrazol-3-yl)-2-methylpropanoic acid?
The InChIKey is AHJUOVWNILNXOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13BrN2O2/c1-5-6(10)7(11-12(5)4)9(2,3)8(13)14/h1-4H3,(H,13,14).
What are the key properties of 2-(4-bromo-1,5-dimethylpyrazol-3-yl)-2-methylpropanoic acid?
2-(4-bromo-1,5-dimethylpyrazol-3-yl)-2-methylpropanoic acid has a molecular weight of 261.12 g/mol, XLogP of 1.85, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromo-1,5-dimethylpyrazol-3-yl)-2-methylpropanoic acid is sourced from PubChem (CID 116818937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).