About [1-[4-bromo-1-(2,4-dimethylphenyl)pyrazol-3-yl]cyclopropyl]methanamine
[1-[4-bromo-1-(2,4-dimethylphenyl)pyrazol-3-yl]cyclopropyl]methanamine (PubChem CID 116818996) has the molecular formula C15H18BrN3
and a molecular weight of 320.23 g/mol. Its IUPAC name is [1-[4-bromo-1-(2,4-dimethylphenyl)pyrazol-3-yl]cyclopropyl]methanamine.
Molecular Properties
| Compound Name | [1-[4-bromo-1-(2,4-dimethylphenyl)pyrazol-3-yl]cyclopropyl]methanamine |
| PubChem CID | 116818996 |
| Molecular Formula | C15H18BrN3 |
| Molecular Weight | 320.23 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | [1-[4-bromo-1-(2,4-dimethylphenyl)pyrazol-3-yl]cyclopropyl]methanamine |
| SMILES | Cc1ccc(-n2cc(Br)c(C3(CN)CC3)n2)c(C)c1 |
| InChI | InChI=1S/C15H18BrN3/c1-10-3-4-13(11(2)7-10)19-8-12(16)14(18-19)15(9-17)5-6-15/h3-4,7-8H,5-6,9,17H2,1-2H3 |
| InChIKey | PVEXZIJVPNIDAA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.23 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-[4-bromo-1-(2,4-dimethylphenyl)pyrazol-3-yl]cyclopropyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[4-bromo-1-(2,4-dimethylphenyl)pyrazol-3-yl]cyclopropyl]methanamine?
The IUPAC name of [1-[4-bromo-1-(2,4-dimethylphenyl)pyrazol-3-yl]cyclopropyl]methanamine (CID 116818996) is [1-[4-bromo-1-(2,4-dimethylphenyl)pyrazol-3-yl]cyclopropyl]methanamine.
What is the SMILES notation for [1-[4-bromo-1-(2,4-dimethylphenyl)pyrazol-3-yl]cyclopropyl]methanamine?
The canonical SMILES for [1-[4-bromo-1-(2,4-dimethylphenyl)pyrazol-3-yl]cyclopropyl]methanamine is Cc1ccc(-n2cc(Br)c(C3(CN)CC3)n2)c(C)c1.
What is the InChIKey of [1-[4-bromo-1-(2,4-dimethylphenyl)pyrazol-3-yl]cyclopropyl]methanamine?
The InChIKey is PVEXZIJVPNIDAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18BrN3/c1-10-3-4-13(11(2)7-10)19-8-12(16)14(18-19)15(9-17)5-6-15/h3-4,7-8H,5-6,9,17H2,1-2H3.
What are the key properties of [1-[4-bromo-1-(2,4-dimethylphenyl)pyrazol-3-yl]cyclopropyl]methanamine?
[1-[4-bromo-1-(2,4-dimethylphenyl)pyrazol-3-yl]cyclopropyl]methanamine has a molecular weight of 320.23 g/mol, XLogP of 3.24, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[4-bromo-1-(2,4-dimethylphenyl)pyrazol-3-yl]cyclopropyl]methanamine is sourced from PubChem (CID 116818996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).