About (2,4,5-trimethylphenyl) N-(cyanomethyl)-N-methylcarbamate
(2,4,5-trimethylphenyl) N-(cyanomethyl)-N-methylcarbamate (PubChem CID 116819820) has the molecular formula C13H16N2O2
and a molecular weight of 232.28 g/mol. Its IUPAC name is (2,4,5-trimethylphenyl) N-(cyanomethyl)-N-methylcarbamate.
Molecular Properties
| Compound Name | (2,4,5-trimethylphenyl) N-(cyanomethyl)-N-methylcarbamate |
| PubChem CID | 116819820 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | (2,4,5-trimethylphenyl) N-(cyanomethyl)-N-methylcarbamate |
| SMILES | Cc1cc(C)c(OC(=O)N(C)CC#N)cc1C |
| InChI | InChI=1S/C13H16N2O2/c1-9-7-11(3)12(8-10(9)2)17-13(16)15(4)6-5-14/h7-8H,6H2,1-4H3 |
| InChIKey | CPXLTJONAHDEEP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze (2,4,5-trimethylphenyl) N-(cyanomethyl)-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4,5-trimethylphenyl) N-(cyanomethyl)-N-methylcarbamate?
The IUPAC name of (2,4,5-trimethylphenyl) N-(cyanomethyl)-N-methylcarbamate (CID 116819820) is (2,4,5-trimethylphenyl) N-(cyanomethyl)-N-methylcarbamate.
What is the SMILES notation for (2,4,5-trimethylphenyl) N-(cyanomethyl)-N-methylcarbamate?
The canonical SMILES for (2,4,5-trimethylphenyl) N-(cyanomethyl)-N-methylcarbamate is Cc1cc(C)c(OC(=O)N(C)CC#N)cc1C.
What is the InChIKey of (2,4,5-trimethylphenyl) N-(cyanomethyl)-N-methylcarbamate?
The InChIKey is CPXLTJONAHDEEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O2/c1-9-7-11(3)12(8-10(9)2)17-13(16)15(4)6-5-14/h7-8H,6H2,1-4H3.
What are the key properties of (2,4,5-trimethylphenyl) N-(cyanomethyl)-N-methylcarbamate?
(2,4,5-trimethylphenyl) N-(cyanomethyl)-N-methylcarbamate has a molecular weight of 232.28 g/mol, XLogP of 2.57, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4,5-trimethylphenyl) N-(cyanomethyl)-N-methylcarbamate is sourced from PubChem (CID 116819820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).