C15H30N2O+2 — CID 11682
1,1,2,5-tetramethyl-5-(1-methylpiperidin-1-ium-1-yl)piperidin-1-ium-4-one (PubChem CID 11682) has the molecular formula C15H30N2O+2 and a molecular weight of 254.42 g/mol. Its IUPAC name is 1,1,2,5-tetramethyl-5-(1-methylpiperidin-1-ium-1-yl)piperidin-1-ium-4-one.
| Compound Name | 1,1,2,5-tetramethyl-5-(1-methylpiperidin-1-ium-1-yl)piperidin-1-ium-4-one |
|---|---|
| PubChem CID | 11682 |
| Molecular Formula | C15H30N2O+2 |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.23 |
| IUPAC Name | 1,1,2,5-tetramethyl-5-(1-methylpiperidin-1-ium-1-yl)piperidin-1-ium-4-one |
| SMILES | CC1CC(=O)C(C)([N+]2(C)CCCCC2)C[N+]1(C)C |
| InChI | InChI=1S/C15H30N2O/c1-13-11-14(18)15(2,12-16(13,3)4)17(5)9-7-6-8-10-17/h13H,6-12H2,1-5H3/q+2 |
| InChIKey | QSIWBFWQWCYEQE-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|