About (2-bromophenyl) 2,7-diazaspiro[4.4]nonane-2-carboxylate
(2-bromophenyl) 2,7-diazaspiro[4.4]nonane-2-carboxylate (PubChem CID 116820006) has the molecular formula C14H17BrN2O2
and a molecular weight of 325.21 g/mol. Its IUPAC name is (2-bromophenyl) 2,7-diazaspiro[4.4]nonane-2-carboxylate.
Molecular Properties
| Compound Name | (2-bromophenyl) 2,7-diazaspiro[4.4]nonane-2-carboxylate |
| PubChem CID | 116820006 |
| Molecular Formula | C14H17BrN2O2 |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | (2-bromophenyl) 2,7-diazaspiro[4.4]nonane-2-carboxylate |
| SMILES | O=C(Oc1ccccc1Br)N1CCC2(CCNC2)C1 |
| InChI | InChI=1S/C14H17BrN2O2/c15-11-3-1-2-4-12(11)19-13(18)17-8-6-14(10-17)5-7-16-9-14/h1-4,16H,5-10H2 |
| InChIKey | MHALMYPCPJSUPO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-bromophenyl) 2,7-diazaspiro[4.4]nonane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromophenyl) 2,7-diazaspiro[4.4]nonane-2-carboxylate?
The IUPAC name of (2-bromophenyl) 2,7-diazaspiro[4.4]nonane-2-carboxylate (CID 116820006) is (2-bromophenyl) 2,7-diazaspiro[4.4]nonane-2-carboxylate.
What is the SMILES notation for (2-bromophenyl) 2,7-diazaspiro[4.4]nonane-2-carboxylate?
The canonical SMILES for (2-bromophenyl) 2,7-diazaspiro[4.4]nonane-2-carboxylate is O=C(Oc1ccccc1Br)N1CCC2(CCNC2)C1.
What is the InChIKey of (2-bromophenyl) 2,7-diazaspiro[4.4]nonane-2-carboxylate?
The InChIKey is MHALMYPCPJSUPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17BrN2O2/c15-11-3-1-2-4-12(11)19-13(18)17-8-6-14(10-17)5-7-16-9-14/h1-4,16H,5-10H2.
What are the key properties of (2-bromophenyl) 2,7-diazaspiro[4.4]nonane-2-carboxylate?
(2-bromophenyl) 2,7-diazaspiro[4.4]nonane-2-carboxylate has a molecular weight of 325.21 g/mol, XLogP of 2.63, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromophenyl) 2,7-diazaspiro[4.4]nonane-2-carboxylate is sourced from PubChem (CID 116820006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).