About 5-(5,6,7,8-tetrahydronaphthalen-2-yloxy)thiatriazole
5-(5,6,7,8-tetrahydronaphthalen-2-yloxy)thiatriazole (PubChem CID 116820223) has the molecular formula C11H11N3OS
and a molecular weight of 233.30 g/mol. Its IUPAC name is 5-(5,6,7,8-tetrahydronaphthalen-2-yloxy)thiatriazole.
Molecular Properties
| Compound Name | 5-(5,6,7,8-tetrahydronaphthalen-2-yloxy)thiatriazole |
| PubChem CID | 116820223 |
| Molecular Formula | C11H11N3OS |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 5-(5,6,7,8-tetrahydronaphthalen-2-yloxy)thiatriazole |
| SMILES | c1cc2c(cc1Oc1nnns1)CCCC2 |
| InChI | InChI=1S/C11H11N3OS/c1-2-4-9-7-10(6-5-8(9)3-1)15-11-12-13-14-16-11/h5-7H,1-4H2 |
| InChIKey | FOCKJUVCEMDUMA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(5,6,7,8-tetrahydronaphthalen-2-yloxy)thiatriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5,6,7,8-tetrahydronaphthalen-2-yloxy)thiatriazole?
The IUPAC name of 5-(5,6,7,8-tetrahydronaphthalen-2-yloxy)thiatriazole (CID 116820223) is 5-(5,6,7,8-tetrahydronaphthalen-2-yloxy)thiatriazole.
What is the SMILES notation for 5-(5,6,7,8-tetrahydronaphthalen-2-yloxy)thiatriazole?
The canonical SMILES for 5-(5,6,7,8-tetrahydronaphthalen-2-yloxy)thiatriazole is c1cc2c(cc1Oc1nnns1)CCCC2.
What is the InChIKey of 5-(5,6,7,8-tetrahydronaphthalen-2-yloxy)thiatriazole?
The InChIKey is FOCKJUVCEMDUMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3OS/c1-2-4-9-7-10(6-5-8(9)3-1)15-11-12-13-14-16-11/h5-7H,1-4H2.
What are the key properties of 5-(5,6,7,8-tetrahydronaphthalen-2-yloxy)thiatriazole?
5-(5,6,7,8-tetrahydronaphthalen-2-yloxy)thiatriazole has a molecular weight of 233.30 g/mol, XLogP of 2.60, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5,6,7,8-tetrahydronaphthalen-2-yloxy)thiatriazole is sourced from PubChem (CID 116820223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).