C20H23FO5 — CID 11682042
(1R,2S,3R,4R,6R)-4-[2-[(4-fluorophenyl)methyl]phenoxy]-6-(hydroxymethyl)cyclohexane-1,2,3-triol (PubChem CID 11682042) has the molecular formula C20H23FO5 and a molecular weight of 362.40 g/mol. Its IUPAC name is (1R,2S,3R,4R,6R)-4-[2-[(4-fluorophenyl)methyl]phenoxy]-6-(hydroxymethyl)cyclohexane-1,2,3-triol.
| Compound Name | (1R,2S,3R,4R,6R)-4-[2-[(4-fluorophenyl)methyl]phenoxy]-6-(hydroxymethyl)cyclohexane-1,2,3-triol |
|---|---|
| PubChem CID | 11682042 |
| Molecular Formula | C20H23FO5 |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | (1R,2S,3R,4R,6R)-4-[2-[(4-fluorophenyl)methyl]phenoxy]-6-(hydroxymethyl)cyclohexane-1,2,3-triol |
| SMILES | OC[C@H]1C[C@@H](Oc2ccccc2Cc2ccc(F)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H23FO5/c21-15-7-5-12(6-8-15)9-13-3-1-2-4-16(13)26-17-10-14(11-22)18(23)20(25)19(17)24/h1-8,14,17-20,22-25H,9-11H2/t14-,17-,18-,19+,20+/m1/s1 |
| InChIKey | WAXHPYKWBMVOGN-SBUWESJJSA-N |
| XLogP | 1.26 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |