C12H18N2O4 — CID 116820842
2-(3,5-dimethoxyphenoxy)-N',N'-dimethylacetohydrazide (PubChem CID 116820842) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-(3,5-dimethoxyphenoxy)-N',N'-dimethylacetohydrazide.
| Compound Name | 2-(3,5-dimethoxyphenoxy)-N',N'-dimethylacetohydrazide |
|---|---|
| PubChem CID | 116820842 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 2-(3,5-dimethoxyphenoxy)-N',N'-dimethylacetohydrazide |
| SMILES | COc1cc(OC)cc(OCC(=O)NN(C)C)c1 |
| InChI | InChI=1S/C12H18N2O4/c1-14(2)13-12(15)8-18-11-6-9(16-3)5-10(7-11)17-4/h5-7H,8H2,1-4H3,(H,13,15) |
| InChIKey | QVRSSHZTYJNEIR-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|