About 4-(3-chlorophenoxy)-2,2-dimethylpyrrolidine
4-(3-chlorophenoxy)-2,2-dimethylpyrrolidine (PubChem CID 116821052) has the molecular formula C12H16ClNO
and a molecular weight of 225.72 g/mol. Its IUPAC name is 4-(3-chlorophenoxy)-2,2-dimethylpyrrolidine.
Molecular Properties
| Compound Name | 4-(3-chlorophenoxy)-2,2-dimethylpyrrolidine |
| PubChem CID | 116821052 |
| Molecular Formula | C12H16ClNO |
| Molecular Weight | 225.72 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 4-(3-chlorophenoxy)-2,2-dimethylpyrrolidine |
| SMILES | CC1(C)CC(Oc2cccc(Cl)c2)CN1 |
| InChI | InChI=1S/C12H16ClNO/c1-12(2)7-11(8-14-12)15-10-5-3-4-9(13)6-10/h3-6,11,14H,7-8H2,1-2H3 |
| InChIKey | IPTAUHCXCVYXKZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.72 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(3-chlorophenoxy)-2,2-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-chlorophenoxy)-2,2-dimethylpyrrolidine?
The IUPAC name of 4-(3-chlorophenoxy)-2,2-dimethylpyrrolidine (CID 116821052) is 4-(3-chlorophenoxy)-2,2-dimethylpyrrolidine.
What is the SMILES notation for 4-(3-chlorophenoxy)-2,2-dimethylpyrrolidine?
The canonical SMILES for 4-(3-chlorophenoxy)-2,2-dimethylpyrrolidine is CC1(C)CC(Oc2cccc(Cl)c2)CN1.
What is the InChIKey of 4-(3-chlorophenoxy)-2,2-dimethylpyrrolidine?
The InChIKey is IPTAUHCXCVYXKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16ClNO/c1-12(2)7-11(8-14-12)15-10-5-3-4-9(13)6-10/h3-6,11,14H,7-8H2,1-2H3.
What are the key properties of 4-(3-chlorophenoxy)-2,2-dimethylpyrrolidine?
4-(3-chlorophenoxy)-2,2-dimethylpyrrolidine has a molecular weight of 225.72 g/mol, XLogP of 2.86, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-chlorophenoxy)-2,2-dimethylpyrrolidine is sourced from PubChem (CID 116821052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).