C11H12F10O2 — CID 11682113
6-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]hex-1-ene (PubChem CID 11682113) has the molecular formula C11H12F10O2 and a molecular weight of 366.20 g/mol. Its IUPAC name is 6-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]hex-1-ene.
| Compound Name | 6-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]hex-1-ene |
|---|---|
| PubChem CID | 11682113 |
| Molecular Formula | C11H12F10O2 |
| Molecular Weight | 366.20 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 6-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]hex-1-ene |
| SMILES | C=CCCCCOC(F)(F)C(F)OC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H12F10O2/c1-2-3-4-5-6-22-8(13,14)7(12)23-11(20,21)9(15,16)10(17,18)19/h2,7H,1,3-6H2 |
| InChIKey | GZZHRPBWYTZHNE-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.20 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|