methyl 3-amino-4-(2,3,6-trimethylphenoxy)butanoate

C14H21NO3 — CID 116821296

IUPACmethyl 3-amino-4-(2,3,6-trimethylphenoxy)butanoate
SMILESCOC(=O)CC(N)COc1c(C)ccc(C)c1C
InChIInChI=1S/C14H21NO3/c1-9-5-6-10(2)14(11(9)3)18-8-12(15)7-13(16)17-4/h5-6,12H,7-8,15H2,1-4H3
InChIKeyCZCXBHXPOWUQOK-UHFFFAOYSA-N
MW251.33 g/mol
LogP1.88
Rot. Bonds5

About methyl 3-amino-4-(2,3,6-trimethylphenoxy)butanoate

methyl 3-amino-4-(2,3,6-trimethylphenoxy)butanoate (PubChem CID 116821296) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is methyl 3-amino-4-(2,3,6-trimethylphenoxy)butanoate.

Molecular Properties

Compound Namemethyl 3-amino-4-(2,3,6-trimethylphenoxy)butanoate
PubChem CID116821296
Molecular FormulaC14H21NO3
Molecular Weight251.33 g/mol
Exact Mass251.15
IUPAC Namemethyl 3-amino-4-(2,3,6-trimethylphenoxy)butanoate
SMILESCOC(=O)CC(N)COc1c(C)ccc(C)c1C
InChIInChI=1S/C14H21NO3/c1-9-5-6-10(2)14(11(9)3)18-8-12(15)7-13(16)17-4/h5-6,12H,7-8,15H2,1-4H3
InChIKeyCZCXBHXPOWUQOK-UHFFFAOYSA-N
XLogP1.88
TPSA61.55 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.33
LogP ≤ 51.88
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 3-amino-4-(2,3,6-trimethylphenoxy)butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-amino-4-(2,3,6-trimethylphenoxy)butanoate?
The IUPAC name of methyl 3-amino-4-(2,3,6-trimethylphenoxy)butanoate (CID 116821296) is methyl 3-amino-4-(2,3,6-trimethylphenoxy)butanoate.
What is the SMILES notation for methyl 3-amino-4-(2,3,6-trimethylphenoxy)butanoate?
The canonical SMILES for methyl 3-amino-4-(2,3,6-trimethylphenoxy)butanoate is COC(=O)CC(N)COc1c(C)ccc(C)c1C.
What is the InChIKey of methyl 3-amino-4-(2,3,6-trimethylphenoxy)butanoate?
The InChIKey is CZCXBHXPOWUQOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO3/c1-9-5-6-10(2)14(11(9)3)18-8-12(15)7-13(16)17-4/h5-6,12H,7-8,15H2,1-4H3.
What are the key properties of methyl 3-amino-4-(2,3,6-trimethylphenoxy)butanoate?
methyl 3-amino-4-(2,3,6-trimethylphenoxy)butanoate has a molecular weight of 251.33 g/mol, XLogP of 1.88, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-amino-4-(2,3,6-trimethylphenoxy)butanoate is sourced from PubChem (CID 116821296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).