C17H11F6N3 — CID 11682215
4-methyl-3,5-bis[2-(trifluoromethyl)phenyl]-1,2,4-triazole (PubChem CID 11682215) has the molecular formula C17H11F6N3 and a molecular weight of 371.28 g/mol. Its IUPAC name is 4-methyl-3,5-bis[2-(trifluoromethyl)phenyl]-1,2,4-triazole.
| Compound Name | 4-methyl-3,5-bis[2-(trifluoromethyl)phenyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 11682215 |
| Molecular Formula | C17H11F6N3 |
| Molecular Weight | 371.28 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 4-methyl-3,5-bis[2-(trifluoromethyl)phenyl]-1,2,4-triazole |
| SMILES | Cn1c(-c2ccccc2C(F)(F)F)nnc1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C17H11F6N3/c1-26-14(10-6-2-4-8-12(10)16(18,19)20)24-25-15(26)11-7-3-5-9-13(11)17(21,22)23/h2-9H,1H3 |
| InChIKey | CKRIFUKNNIFAOQ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.28 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |