C9H14ClNO2 — CID 116822710
3-chloro-1-(1-methylpiperidin-3-yl)propane-1,2-dione (PubChem CID 116822710) has the molecular formula C9H14ClNO2 and a molecular weight of 203.67 g/mol. Its IUPAC name is 3-chloro-1-(1-methylpiperidin-3-yl)propane-1,2-dione.
| Compound Name | 3-chloro-1-(1-methylpiperidin-3-yl)propane-1,2-dione |
|---|---|
| PubChem CID | 116822710 |
| Molecular Formula | C9H14ClNO2 |
| Molecular Weight | 203.67 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 3-chloro-1-(1-methylpiperidin-3-yl)propane-1,2-dione |
| SMILES | CN1CCCC(C(=O)C(=O)CCl)C1 |
| InChI | InChI=1S/C9H14ClNO2/c1-11-4-2-3-7(6-11)9(13)8(12)5-10/h7H,2-6H2,1H3 |
| InChIKey | AENNXIQBECEYKN-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.67 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|