About (4-nitrophenyl) (2-oxo-1,2-diphenylethyl) carbonate
(4-nitrophenyl) (2-oxo-1,2-diphenylethyl) carbonate (PubChem CID 11682311) has the molecular formula C21H15NO6
and a molecular weight of 377.35 g/mol. Its IUPAC name is (4-nitrophenyl) (2-oxo-1,2-diphenylethyl) carbonate.
Molecular Properties
| Compound Name | (4-nitrophenyl) (2-oxo-1,2-diphenylethyl) carbonate |
| PubChem CID | 11682311 |
| Molecular Formula | C21H15NO6 |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | (4-nitrophenyl) (2-oxo-1,2-diphenylethyl) carbonate |
| SMILES | O=C(Oc1ccc([N+](=O)[O-])cc1)OC(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H15NO6/c23-19(15-7-3-1-4-8-15)20(16-9-5-2-6-10-16)28-21(24)27-18-13-11-17(12-14-18)22(25)26/h1-14,20H |
| InChIKey | APRUKPRTYWPBCN-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl) (2-oxo-1,2-diphenylethyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl) (2-oxo-1,2-diphenylethyl) carbonate?
The IUPAC name of (4-nitrophenyl) (2-oxo-1,2-diphenylethyl) carbonate (CID 11682311) is (4-nitrophenyl) (2-oxo-1,2-diphenylethyl) carbonate.
What is the SMILES notation for (4-nitrophenyl) (2-oxo-1,2-diphenylethyl) carbonate?
The canonical SMILES for (4-nitrophenyl) (2-oxo-1,2-diphenylethyl) carbonate is O=C(Oc1ccc([N+](=O)[O-])cc1)OC(C(=O)c1ccccc1)c1ccccc1.
What is the InChIKey of (4-nitrophenyl) (2-oxo-1,2-diphenylethyl) carbonate?
The InChIKey is APRUKPRTYWPBCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15NO6/c23-19(15-7-3-1-4-8-15)20(16-9-5-2-6-10-16)28-21(24)27-18-13-11-17(12-14-18)22(25)26/h1-14,20H.
What are the key properties of (4-nitrophenyl) (2-oxo-1,2-diphenylethyl) carbonate?
(4-nitrophenyl) (2-oxo-1,2-diphenylethyl) carbonate has a molecular weight of 377.35 g/mol, XLogP of 4.73, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl) (2-oxo-1,2-diphenylethyl) carbonate is sourced from PubChem (CID 11682311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).