C12H14N4 — CID 116823137
6-(2,4-dimethylphenyl)-N-methyl-1,2,4-triazin-5-amine (PubChem CID 116823137) has the molecular formula C12H14N4 and a molecular weight of 214.27 g/mol. Its IUPAC name is 6-(2,4-dimethylphenyl)-N-methyl-1,2,4-triazin-5-amine.
| Compound Name | 6-(2,4-dimethylphenyl)-N-methyl-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 116823137 |
| Molecular Formula | C12H14N4 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 6-(2,4-dimethylphenyl)-N-methyl-1,2,4-triazin-5-amine |
| SMILES | CNc1ncnnc1-c1ccc(C)cc1C |
| InChI | InChI=1S/C12H14N4/c1-8-4-5-10(9(2)6-8)11-12(13-3)14-7-15-16-11/h4-7H,1-3H3,(H,13,14,15) |
| InChIKey | OCVKAXJELZJNNS-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |