C12H19N5 — CID 116823684
6-cyclobutyl-3-methyl-5-piperazin-1-yl-1,2,4-triazine (PubChem CID 116823684) has the molecular formula C12H19N5 and a molecular weight of 233.32 g/mol. Its IUPAC name is 6-cyclobutyl-3-methyl-5-piperazin-1-yl-1,2,4-triazine.
| Compound Name | 6-cyclobutyl-3-methyl-5-piperazin-1-yl-1,2,4-triazine |
|---|---|
| PubChem CID | 116823684 |
| Molecular Formula | C12H19N5 |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 6-cyclobutyl-3-methyl-5-piperazin-1-yl-1,2,4-triazine |
| SMILES | Cc1nnc(C2CCC2)c(N2CCNCC2)n1 |
| InChI | InChI=1S/C12H19N5/c1-9-14-12(17-7-5-13-6-8-17)11(16-15-9)10-3-2-4-10/h10,13H,2-8H2,1H3 |
| InChIKey | HGQMSTDIPFAJPT-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |