C11H17N5 — CID 116824028
3-cyclobutyl-5-piperazin-1-yl-1,2,4-triazine (PubChem CID 116824028) has the molecular formula C11H17N5 and a molecular weight of 219.29 g/mol. Its IUPAC name is 3-cyclobutyl-5-piperazin-1-yl-1,2,4-triazine.
| Compound Name | 3-cyclobutyl-5-piperazin-1-yl-1,2,4-triazine |
|---|---|
| PubChem CID | 116824028 |
| Molecular Formula | C11H17N5 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 3-cyclobutyl-5-piperazin-1-yl-1,2,4-triazine |
| SMILES | c1nnc(C2CCC2)nc1N1CCNCC1 |
| InChI | InChI=1S/C11H17N5/c1-2-9(3-1)11-14-10(8-13-15-11)16-6-4-12-5-7-16/h8-9,12H,1-7H2 |
| InChIKey | ZMIKRDDVVDPIQL-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |