C19H20N4O5 — CID 11682444
5-[1-(1,3-benzodioxol-5-yl)-2-(methoxymethoxy)ethoxy]quinazoline-2,4-diamine (PubChem CID 11682444) has the molecular formula C19H20N4O5 and a molecular weight of 384.39 g/mol. Its IUPAC name is 5-[1-(1,3-benzodioxol-5-yl)-2-(methoxymethoxy)ethoxy]quinazoline-2,4-diamine.
| Compound Name | 5-[1-(1,3-benzodioxol-5-yl)-2-(methoxymethoxy)ethoxy]quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 11682444 |
| Molecular Formula | C19H20N4O5 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 5-[1-(1,3-benzodioxol-5-yl)-2-(methoxymethoxy)ethoxy]quinazoline-2,4-diamine |
| SMILES | COCOCC(Oc1cccc2nc(N)nc(N)c12)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H20N4O5/c1-24-9-25-8-16(11-5-6-13-15(7-11)27-10-26-13)28-14-4-2-3-12-17(14)18(20)23-19(21)22-12/h2-7,16H,8-10H2,1H3,(H4,20,21,22,23) |
| InChIKey | MEJZAKRTKPPYSN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 123.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|