2-pyridin-3-yl-2-(2,3,4-trimethylphenyl)acetic acid

C16H17NO2 — CID 116824877

IUPAC2-pyridin-3-yl-2-(2,3,4-trimethylphenyl)acetic acid
SMILESCc1ccc(C(C(=O)O)c2cccnc2)c(C)c1C
InChIInChI=1S/C16H17NO2/c1-10-6-7-14(12(3)11(10)2)15(16(18)19)13-5-4-8-17-9-13/h4-9,15H,1-3H3,(H,18,19)
InChIKeyMVMKXENEXFVQEB-UHFFFAOYSA-N
MW255.32 g/mol
LogP3.22
Rot. Bonds3

About 2-pyridin-3-yl-2-(2,3,4-trimethylphenyl)acetic acid

2-pyridin-3-yl-2-(2,3,4-trimethylphenyl)acetic acid (PubChem CID 116824877) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is 2-pyridin-3-yl-2-(2,3,4-trimethylphenyl)acetic acid.

Molecular Properties

Compound Name2-pyridin-3-yl-2-(2,3,4-trimethylphenyl)acetic acid
PubChem CID116824877
Molecular FormulaC16H17NO2
Molecular Weight255.32 g/mol
Exact Mass255.13
IUPAC Name2-pyridin-3-yl-2-(2,3,4-trimethylphenyl)acetic acid
SMILESCc1ccc(C(C(=O)O)c2cccnc2)c(C)c1C
InChIInChI=1S/C16H17NO2/c1-10-6-7-14(12(3)11(10)2)15(16(18)19)13-5-4-8-17-9-13/h4-9,15H,1-3H3,(H,18,19)
InChIKeyMVMKXENEXFVQEB-UHFFFAOYSA-N
XLogP3.22
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.32
LogP ≤ 53.22
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-pyridin-3-yl-2-(2,3,4-trimethylphenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-pyridin-3-yl-2-(2,3,4-trimethylphenyl)acetic acid?
The IUPAC name of 2-pyridin-3-yl-2-(2,3,4-trimethylphenyl)acetic acid (CID 116824877) is 2-pyridin-3-yl-2-(2,3,4-trimethylphenyl)acetic acid.
What is the SMILES notation for 2-pyridin-3-yl-2-(2,3,4-trimethylphenyl)acetic acid?
The canonical SMILES for 2-pyridin-3-yl-2-(2,3,4-trimethylphenyl)acetic acid is Cc1ccc(C(C(=O)O)c2cccnc2)c(C)c1C.
What is the InChIKey of 2-pyridin-3-yl-2-(2,3,4-trimethylphenyl)acetic acid?
The InChIKey is MVMKXENEXFVQEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO2/c1-10-6-7-14(12(3)11(10)2)15(16(18)19)13-5-4-8-17-9-13/h4-9,15H,1-3H3,(H,18,19).
What are the key properties of 2-pyridin-3-yl-2-(2,3,4-trimethylphenyl)acetic acid?
2-pyridin-3-yl-2-(2,3,4-trimethylphenyl)acetic acid has a molecular weight of 255.32 g/mol, XLogP of 3.22, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-3-yl-2-(2,3,4-trimethylphenyl)acetic acid is sourced from PubChem (CID 116824877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).