C19H23NO8 — CID 11682632
N-[7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-2-oxochromen-3-yl]acetamide (PubChem CID 11682632) has the molecular formula C19H23NO8 and a molecular weight of 393.39 g/mol. Its IUPAC name is N-[7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-2-oxochromen-3-yl]acetamide.
| Compound Name | N-[7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-2-oxochromen-3-yl]acetamide |
|---|---|
| PubChem CID | 11682632 |
| Molecular Formula | C19H23NO8 |
| Molecular Weight | 393.39 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | N-[7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-2-oxochromen-3-yl]acetamide |
| SMILES | CO[C@@H]1[C@@H](O)[C@@H](O)[C@H](Oc2ccc3cc(NC(C)=O)c(=O)oc3c2)OC1(C)C |
| InChI | InChI=1S/C19H23NO8/c1-9(21)20-12-7-10-5-6-11(8-13(10)27-17(12)24)26-18-15(23)14(22)16(25-4)19(2,3)28-18/h5-8,14-16,18,22-23H,1-4H3,(H,20,21)/t14-,15+,16+,18+/m0/s1 |
| InChIKey | XIIBGBGDPWRIPK-BVIKNXMNSA-N |
| XLogP | 1.00 |
| TPSA | 127.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.39 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|