C23H30N4O2 — CID 11682662
N-(2-methoxyethyl)-3-[3-(2,6,7-triazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraen-8-yl)phenoxy]propan-1-amine (PubChem CID 11682662) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-[3-(2,6,7-triazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraen-8-yl)phenoxy]propan-1-amine.
| Compound Name | N-(2-methoxyethyl)-3-[3-(2,6,7-triazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraen-8-yl)phenoxy]propan-1-amine |
|---|---|
| PubChem CID | 11682662 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | N-(2-methoxyethyl)-3-[3-(2,6,7-triazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraen-8-yl)phenoxy]propan-1-amine |
| SMILES | COCCNCCCOc1cccc(-c2c3c(nc4ccnn24)CCCCC3)c1 |
| InChI | InChI=1S/C23H30N4O2/c1-28-16-14-24-12-6-15-29-19-8-5-7-18(17-19)23-20-9-3-2-4-10-21(20)26-22-11-13-25-27(22)23/h5,7-8,11,13,17,24H,2-4,6,9-10,12,14-16H2,1H3 |
| InChIKey | OBFIYWOBFKRLCB-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|