C22H29N3O4 — CID 11682746
oxalic acid;1-phenyl-4-(2-piperidin-1-ylethyl)-4,5,6,7-tetrahydroindazole (PubChem CID 11682746) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is oxalic acid;1-phenyl-4-(2-piperidin-1-ylethyl)-4,5,6,7-tetrahydroindazole.
| Compound Name | oxalic acid;1-phenyl-4-(2-piperidin-1-ylethyl)-4,5,6,7-tetrahydroindazole |
|---|---|
| PubChem CID | 11682746 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | oxalic acid;1-phenyl-4-(2-piperidin-1-ylethyl)-4,5,6,7-tetrahydroindazole |
| SMILES | O=C(O)C(=O)O.c1ccc(-n2ncc3c2CCCC3CCN2CCCCC2)cc1 |
| InChI | InChI=1S/C20H27N3.C2H2O4/c1-3-9-18(10-4-1)23-20-11-7-8-17(19(20)16-21-23)12-15-22-13-5-2-6-14-22;3-1(4)2(5)6/h1,3-4,9-10,16-17H,2,5-8,11-15H2;(H,3,4)(H,5,6) |
| InChIKey | CAZKLJIFYMRBNA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|