C10H13N3O — CID 116827492
N,1-dimethyl-5-(5-methylfuran-2-yl)pyrazol-3-amine (PubChem CID 116827492) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is N,1-dimethyl-5-(5-methylfuran-2-yl)pyrazol-3-amine.
| Compound Name | N,1-dimethyl-5-(5-methylfuran-2-yl)pyrazol-3-amine |
|---|---|
| PubChem CID | 116827492 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | N,1-dimethyl-5-(5-methylfuran-2-yl)pyrazol-3-amine |
| SMILES | CNc1cc(-c2ccc(C)o2)n(C)n1 |
| InChI | InChI=1S/C10H13N3O/c1-7-4-5-9(14-7)8-6-10(11-2)12-13(8)3/h4-6H,1-3H3,(H,11,12) |
| InChIKey | MMHBFHZOTKNZEK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 42.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |