C9H18N2S — CID 116828069
methyl N,1-dimethylpiperidine-3-carboximidothioate (PubChem CID 116828069) has the molecular formula C9H18N2S and a molecular weight of 186.32 g/mol. Its IUPAC name is methyl N,1-dimethylpiperidine-3-carboximidothioate.
| Compound Name | methyl N,1-dimethylpiperidine-3-carboximidothioate |
|---|---|
| PubChem CID | 116828069 |
| Molecular Formula | C9H18N2S |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | methyl N,1-dimethylpiperidine-3-carboximidothioate |
| SMILES | C/N=C(\SC)C1CCCN(C)C1 |
| InChI | InChI=1S/C9H18N2S/c1-10-9(12-3)8-5-4-6-11(2)7-8/h8H,4-7H2,1-3H3/b10-9- |
| InChIKey | YQEYOSOMQQCSAS-KTKRTIGZSA-N |
| XLogP | 1.72 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|