C19H19ClFN5O2 — CID 11682843
2-[[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]methyl-methylamino]acetamide (PubChem CID 11682843) has the molecular formula C19H19ClFN5O2 and a molecular weight of 403.85 g/mol. Its IUPAC name is 2-[[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]methyl-methylamino]acetamide.
| Compound Name | 2-[[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]methyl-methylamino]acetamide |
|---|---|
| PubChem CID | 11682843 |
| Molecular Formula | C19H19ClFN5O2 |
| Molecular Weight | 403.85 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 2-[[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]methyl-methylamino]acetamide |
| SMILES | COc1cc2ncnc(Nc3cccc(Cl)c3F)c2cc1CN(C)CC(N)=O |
| InChI | InChI=1S/C19H19ClFN5O2/c1-26(9-17(22)27)8-11-6-12-15(7-16(11)28-2)23-10-24-19(12)25-14-5-3-4-13(20)18(14)21/h3-7,10H,8-9H2,1-2H3,(H2,22,27)(H,23,24,25) |
| InChIKey | ZKIVCEBHTQSSGM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.85 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |