About [5-(4-fluorophenyl)-1,2-dimethylpyrrol-3-yl]methanol
[5-(4-fluorophenyl)-1,2-dimethylpyrrol-3-yl]methanol (PubChem CID 116828846) has the molecular formula C13H14FNO
and a molecular weight of 219.26 g/mol. Its IUPAC name is [5-(4-fluorophenyl)-1,2-dimethylpyrrol-3-yl]methanol.
Molecular Properties
| Compound Name | [5-(4-fluorophenyl)-1,2-dimethylpyrrol-3-yl]methanol |
| PubChem CID | 116828846 |
| Molecular Formula | C13H14FNO |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | [5-(4-fluorophenyl)-1,2-dimethylpyrrol-3-yl]methanol |
| SMILES | Cc1c(CO)cc(-c2ccc(F)cc2)n1C |
| InChI | InChI=1S/C13H14FNO/c1-9-11(8-16)7-13(15(9)2)10-3-5-12(14)6-4-10/h3-7,16H,8H2,1-2H3 |
| InChIKey | AHTUCCZCYXVATD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [5-(4-fluorophenyl)-1,2-dimethylpyrrol-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(4-fluorophenyl)-1,2-dimethylpyrrol-3-yl]methanol?
The IUPAC name of [5-(4-fluorophenyl)-1,2-dimethylpyrrol-3-yl]methanol (CID 116828846) is [5-(4-fluorophenyl)-1,2-dimethylpyrrol-3-yl]methanol.
What is the SMILES notation for [5-(4-fluorophenyl)-1,2-dimethylpyrrol-3-yl]methanol?
The canonical SMILES for [5-(4-fluorophenyl)-1,2-dimethylpyrrol-3-yl]methanol is Cc1c(CO)cc(-c2ccc(F)cc2)n1C.
What is the InChIKey of [5-(4-fluorophenyl)-1,2-dimethylpyrrol-3-yl]methanol?
The InChIKey is AHTUCCZCYXVATD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14FNO/c1-9-11(8-16)7-13(15(9)2)10-3-5-12(14)6-4-10/h3-7,16H,8H2,1-2H3.
What are the key properties of [5-(4-fluorophenyl)-1,2-dimethylpyrrol-3-yl]methanol?
[5-(4-fluorophenyl)-1,2-dimethylpyrrol-3-yl]methanol has a molecular weight of 219.26 g/mol, XLogP of 2.63, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(4-fluorophenyl)-1,2-dimethylpyrrol-3-yl]methanol is sourced from PubChem (CID 116828846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).