C14H19N3O2 — CID 116829262
4-methyl-6-(3-methylpiperazin-2-yl)-1,4-benzoxazin-3-one (PubChem CID 116829262) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 4-methyl-6-(3-methylpiperazin-2-yl)-1,4-benzoxazin-3-one.
| Compound Name | 4-methyl-6-(3-methylpiperazin-2-yl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 116829262 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 4-methyl-6-(3-methylpiperazin-2-yl)-1,4-benzoxazin-3-one |
| SMILES | CC1NCCNC1c1ccc2c(c1)N(C)C(=O)CO2 |
| InChI | InChI=1S/C14H19N3O2/c1-9-14(16-6-5-15-9)10-3-4-12-11(7-10)17(2)13(18)8-19-12/h3-4,7,9,14-16H,5-6,8H2,1-2H3 |
| InChIKey | GHPMDQWQGJVEHR-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |