C17H14ClN9O2 — CID 11683024
1-[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-pyridin-3-ylurea;hydrochloride (PubChem CID 11683024) has the molecular formula C17H14ClN9O2 and a molecular weight of 411.81 g/mol. Its IUPAC name is 1-[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-pyridin-3-ylurea;hydrochloride.
| Compound Name | 1-[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-pyridin-3-ylurea;hydrochloride |
|---|---|
| PubChem CID | 11683024 |
| Molecular Formula | C17H14ClN9O2 |
| Molecular Weight | 411.81 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 1-[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-pyridin-3-ylurea;hydrochloride |
| SMILES | Cl.Cn1cc2c(nc(NC(=O)Nc3cccnc3)n3nc(-c4ccco4)nc23)n1 |
| InChI | InChI=1S/C17H13N9O2.ClH/c1-25-9-11-13(23-25)21-16(22-17(27)19-10-4-2-6-18-8-10)26-15(11)20-14(24-26)12-5-3-7-28-12;/h2-9H,1H3,(H2,19,21,22,23,27);1H |
| InChIKey | XGCQBFAGKHCCMK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 128.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.81 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |