C24H25F3N2O — CID 11683077
3-[4-[4-[3-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridin-1-yl]butyl]-1,3-dihydroindol-2-one (PubChem CID 11683077) has the molecular formula C24H25F3N2O and a molecular weight of 414.47 g/mol. Its IUPAC name is 3-[4-[4-[3-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridin-1-yl]butyl]-1,3-dihydroindol-2-one.
| Compound Name | 3-[4-[4-[3-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridin-1-yl]butyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 11683077 |
| Molecular Formula | C24H25F3N2O |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 3-[4-[4-[3-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridin-1-yl]butyl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2ccccc2C1CCCCN1CC=C(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C24H25F3N2O/c25-24(26,27)19-7-5-6-18(16-19)17-11-14-29(15-12-17)13-4-3-9-21-20-8-1-2-10-22(20)28-23(21)30/h1-2,5-8,10-11,16,21H,3-4,9,12-15H2,(H,28,30) |
| InChIKey | GIIZJZBEFPZVKI-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|