C21H29N3O4S — CID 11683177
5-(azepan-1-ylsulfonyl)-3-methyl-N-(oxolan-2-ylmethyl)-1H-indole-2-carboxamide (PubChem CID 11683177) has the molecular formula C21H29N3O4S and a molecular weight of 419.55 g/mol. Its IUPAC name is 5-(azepan-1-ylsulfonyl)-3-methyl-N-(oxolan-2-ylmethyl)-1H-indole-2-carboxamide.
| Compound Name | 5-(azepan-1-ylsulfonyl)-3-methyl-N-(oxolan-2-ylmethyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 11683177 |
| Molecular Formula | C21H29N3O4S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | 5-(azepan-1-ylsulfonyl)-3-methyl-N-(oxolan-2-ylmethyl)-1H-indole-2-carboxamide |
| SMILES | Cc1c(C(=O)NCC2CCCO2)[nH]c2ccc(S(=O)(=O)N3CCCCCC3)cc12 |
| InChI | InChI=1S/C21H29N3O4S/c1-15-18-13-17(29(26,27)24-10-4-2-3-5-11-24)8-9-19(18)23-20(15)21(25)22-14-16-7-6-12-28-16/h8-9,13,16,23H,2-7,10-12,14H2,1H3,(H,22,25) |
| InChIKey | OUHRFXSAFKXAJZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|