C21H27NO8 — CID 11683220
methyl 2-[(3aR,4S,6S,6aS)-4-[1-acetyloxy-2-(benzylamino)-2-oxoethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]acetate (PubChem CID 11683220) has the molecular formula C21H27NO8 and a molecular weight of 421.45 g/mol. Its IUPAC name is methyl 2-[(3aR,4S,6S,6aS)-4-[1-acetyloxy-2-(benzylamino)-2-oxoethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]acetate.
| Compound Name | methyl 2-[(3aR,4S,6S,6aS)-4-[1-acetyloxy-2-(benzylamino)-2-oxoethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]acetate |
|---|---|
| PubChem CID | 11683220 |
| Molecular Formula | C21H27NO8 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | methyl 2-[(3aR,4S,6S,6aS)-4-[1-acetyloxy-2-(benzylamino)-2-oxoethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]acetate |
| SMILES | COC(=O)C[C@@H]1O[C@H](C(OC(C)=O)C(=O)NCc2ccccc2)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C21H27NO8/c1-12(23)27-19(20(25)22-11-13-8-6-5-7-9-13)17-18-16(29-21(2,3)30-18)14(28-17)10-15(24)26-4/h5-9,14,16-19H,10-11H2,1-4H3,(H,22,25)/t14-,16-,17-,18-,19?/m0/s1 |
| InChIKey | FRYXSOASZNWRLB-LPDACBTHSA-N |
| XLogP | 1.09 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |