C26H50O2Si — CID 11683250
cis-(2R,4R)-3,3-dimethyl-4-(3-methylbut-2-enyl)-2-[(1R)-2-methyl-1-tri(propan-2-yl)silyloxypropyl]cyclohexan-1-one (PubChem CID 11683250) has the molecular formula C26H50O2Si and a molecular weight of 422.77 g/mol. Its IUPAC name is cis-(2R,4R)-3,3-dimethyl-4-(3-methylbut-2-enyl)-2-[(1R)-2-methyl-1-tri(propan-2-yl)silyloxypropyl]cyclohexan-1-one.
| Compound Name | cis-(2R,4R)-3,3-dimethyl-4-(3-methylbut-2-enyl)-2-[(1R)-2-methyl-1-tri(propan-2-yl)silyloxypropyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 11683250 |
| Molecular Formula | C26H50O2Si |
| Molecular Weight | 422.77 g/mol |
| Exact Mass | 422.36 |
| IUPAC Name | cis-(2R,4R)-3,3-dimethyl-4-(3-methylbut-2-enyl)-2-[(1R)-2-methyl-1-tri(propan-2-yl)silyloxypropyl]cyclohexan-1-one |
| SMILES | CC(C)=CC[C@H]1CCC(=O)[C@@H]([C@H](O[Si](C(C)C)(C(C)C)C(C)C)C(C)C)C1(C)C |
| InChI | InChI=1S/C26H50O2Si/c1-17(2)13-14-22-15-16-23(27)24(26(22,11)12)25(18(3)4)28-29(19(5)6,20(7)8)21(9)10/h13,18-22,24-25H,14-16H2,1-12H3/t22-,24-,25+/m0/s1 |
| InChIKey | SQVJIYLWWXPJCU-ZKMPZPQNSA-N |
| XLogP | 8.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.77 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|