C21H15BrN2OS — CID 11683256
13-bromo-5-methyl-4-phenyl-3-thia-7,17-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),2(6),4,11(16),12,14-hexaen-8-one (PubChem CID 11683256) has the molecular formula C21H15BrN2OS and a molecular weight of 423.34 g/mol. Its IUPAC name is 13-bromo-5-methyl-4-phenyl-3-thia-7,17-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),2(6),4,11(16),12,14-hexaen-8-one.
| Compound Name | 13-bromo-5-methyl-4-phenyl-3-thia-7,17-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),2(6),4,11(16),12,14-hexaen-8-one |
|---|---|
| PubChem CID | 11683256 |
| Molecular Formula | C21H15BrN2OS |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 422.01 |
| IUPAC Name | 13-bromo-5-methyl-4-phenyl-3-thia-7,17-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),2(6),4,11(16),12,14-hexaen-8-one |
| SMILES | Cc1c(-c2ccccc2)sc2c1NC(=O)Cc1c-2[nH]c2ccc(Br)cc12 |
| InChI | InChI=1S/C21H15BrN2OS/c1-11-18-21(26-20(11)12-5-3-2-4-6-12)19-15(10-17(25)24-18)14-9-13(22)7-8-16(14)23-19/h2-9,23H,10H2,1H3,(H,24,25) |
| InChIKey | IIKRGTATPNDWGA-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|