C22H21N3O6 — CID 11683258
N-(3-propoxyphenyl)-N'-(1,3,4-trioxoisoquinolin-6-yl)butanediamide (PubChem CID 11683258) has the molecular formula C22H21N3O6 and a molecular weight of 423.43 g/mol. Its IUPAC name is N-(3-propoxyphenyl)-N'-(1,3,4-trioxoisoquinolin-6-yl)butanediamide.
| Compound Name | N-(3-propoxyphenyl)-N'-(1,3,4-trioxoisoquinolin-6-yl)butanediamide |
|---|---|
| PubChem CID | 11683258 |
| Molecular Formula | C22H21N3O6 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | N-(3-propoxyphenyl)-N'-(1,3,4-trioxoisoquinolin-6-yl)butanediamide |
| SMILES | CCCOc1cccc(NC(=O)CCC(=O)Nc2ccc3c(c2)C(=O)C(=O)NC3=O)c1 |
| InChI | InChI=1S/C22H21N3O6/c1-2-10-31-15-5-3-4-13(11-15)23-18(26)8-9-19(27)24-14-6-7-16-17(12-14)20(28)22(30)25-21(16)29/h3-7,11-12H,2,8-10H2,1H3,(H,23,26)(H,24,27)(H,25,29,30) |
| InChIKey | BEQPZGFDJJLPFT-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|