C14H11N3O2 — CID 116832958
1-(2-methyl-1,3-benzoxazol-6-yl)-2-pyridazin-3-ylethanone (PubChem CID 116832958) has the molecular formula C14H11N3O2 and a molecular weight of 253.26 g/mol. Its IUPAC name is 1-(2-methyl-1,3-benzoxazol-6-yl)-2-pyridazin-3-ylethanone.
| Compound Name | 1-(2-methyl-1,3-benzoxazol-6-yl)-2-pyridazin-3-ylethanone |
|---|---|
| PubChem CID | 116832958 |
| Molecular Formula | C14H11N3O2 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 1-(2-methyl-1,3-benzoxazol-6-yl)-2-pyridazin-3-ylethanone |
| SMILES | Cc1nc2ccc(C(=O)Cc3cccnn3)cc2o1 |
| InChI | InChI=1S/C14H11N3O2/c1-9-16-12-5-4-10(7-14(12)19-9)13(18)8-11-3-2-6-15-17-11/h2-7H,8H2,1H3 |
| InChIKey | YVQSSNJMPGBRJC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 68.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |