C26H37NO4 — CID 11683348
[5-(4-hydroxybutoxy)-1-(oxan-4-ylmethyl)indol-3-yl]-(2,2,3,3-tetramethylcyclopropyl)methanone (PubChem CID 11683348) has the molecular formula C26H37NO4 and a molecular weight of 427.59 g/mol. Its IUPAC name is [5-(4-hydroxybutoxy)-1-(oxan-4-ylmethyl)indol-3-yl]-(2,2,3,3-tetramethylcyclopropyl)methanone.
| Compound Name | [5-(4-hydroxybutoxy)-1-(oxan-4-ylmethyl)indol-3-yl]-(2,2,3,3-tetramethylcyclopropyl)methanone |
|---|---|
| PubChem CID | 11683348 |
| Molecular Formula | C26H37NO4 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.27 |
| IUPAC Name | [5-(4-hydroxybutoxy)-1-(oxan-4-ylmethyl)indol-3-yl]-(2,2,3,3-tetramethylcyclopropyl)methanone |
| SMILES | CC1(C)C(C(=O)c2cn(CC3CCOCC3)c3ccc(OCCCCO)cc23)C1(C)C |
| InChI | InChI=1S/C26H37NO4/c1-25(2)24(26(25,3)4)23(29)21-17-27(16-18-9-13-30-14-10-18)22-8-7-19(15-20(21)22)31-12-6-5-11-28/h7-8,15,17-18,24,28H,5-6,9-14,16H2,1-4H3 |
| InChIKey | XKZHZNUJAKUQJN-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|