About 2-(3,4-difluorophenyl)-2-pyrazin-2-ylethanamine
2-(3,4-difluorophenyl)-2-pyrazin-2-ylethanamine (PubChem CID 116833741) has the molecular formula C12H11F2N3
and a molecular weight of 235.24 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-2-pyrazin-2-ylethanamine.
Molecular Properties
| Compound Name | 2-(3,4-difluorophenyl)-2-pyrazin-2-ylethanamine |
| PubChem CID | 116833741 |
| Molecular Formula | C12H11F2N3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 2-(3,4-difluorophenyl)-2-pyrazin-2-ylethanamine |
| SMILES | NCC(c1ccc(F)c(F)c1)c1cnccn1 |
| InChI | InChI=1S/C12H11F2N3/c13-10-2-1-8(5-11(10)14)9(6-15)12-7-16-3-4-17-12/h1-5,7,9H,6,15H2 |
| InChIKey | DWOXWBDJZJUREA-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3,4-difluorophenyl)-2-pyrazin-2-ylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-difluorophenyl)-2-pyrazin-2-ylethanamine?
The IUPAC name of 2-(3,4-difluorophenyl)-2-pyrazin-2-ylethanamine (CID 116833741) is 2-(3,4-difluorophenyl)-2-pyrazin-2-ylethanamine.
What is the SMILES notation for 2-(3,4-difluorophenyl)-2-pyrazin-2-ylethanamine?
The canonical SMILES for 2-(3,4-difluorophenyl)-2-pyrazin-2-ylethanamine is NCC(c1ccc(F)c(F)c1)c1cnccn1.
What is the InChIKey of 2-(3,4-difluorophenyl)-2-pyrazin-2-ylethanamine?
The InChIKey is DWOXWBDJZJUREA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11F2N3/c13-10-2-1-8(5-11(10)14)9(6-15)12-7-16-3-4-17-12/h1-5,7,9H,6,15H2.
What are the key properties of 2-(3,4-difluorophenyl)-2-pyrazin-2-ylethanamine?
2-(3,4-difluorophenyl)-2-pyrazin-2-ylethanamine has a molecular weight of 235.24 g/mol, XLogP of 1.85, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-difluorophenyl)-2-pyrazin-2-ylethanamine is sourced from PubChem (CID 116833741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).