C24H32O7 — CID 11683448
(1S,3R,6R,8S,10R,12S,14R,15S,17R)-17-methoxy-3-methyl-6-phenyl-15-prop-2-enyl-2,5,7,11,16-pentaoxatetracyclo[8.8.0.03,8.012,17]octadecan-14-ol (PubChem CID 11683448) has the molecular formula C24H32O7 and a molecular weight of 432.51 g/mol. Its IUPAC name is (1S,3R,6R,8S,10R,12S,14R,15S,17R)-17-methoxy-3-methyl-6-phenyl-15-prop-2-enyl-2,5,7,11,16-pentaoxatetracyclo[8.8.0.03,8.012,17]octadecan-14-ol.
| Compound Name | (1S,3R,6R,8S,10R,12S,14R,15S,17R)-17-methoxy-3-methyl-6-phenyl-15-prop-2-enyl-2,5,7,11,16-pentaoxatetracyclo[8.8.0.03,8.012,17]octadecan-14-ol |
|---|---|
| PubChem CID | 11683448 |
| Molecular Formula | C24H32O7 |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | (1S,3R,6R,8S,10R,12S,14R,15S,17R)-17-methoxy-3-methyl-6-phenyl-15-prop-2-enyl-2,5,7,11,16-pentaoxatetracyclo[8.8.0.03,8.012,17]octadecan-14-ol |
| SMILES | C=CC[C@@H]1O[C@]2(OC)C[C@@H]3O[C@]4(C)CO[C@@H](c5ccccc5)O[C@H]4C[C@H]3O[C@H]2C[C@H]1O |
| InChI | InChI=1S/C24H32O7/c1-4-8-17-16(25)11-21-24(26-3,31-17)13-19-18(28-21)12-20-23(2,30-19)14-27-22(29-20)15-9-6-5-7-10-15/h4-7,9-10,16-22,25H,1,8,11-14H2,2-3H3/t16-,17+,18-,19+,20+,21+,22-,23-,24-/m1/s1 |
| InChIKey | HXCJSVIMHUHFFI-CJJXGDCZSA-N |
| XLogP | 2.87 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|