C15H20BrN3 — CID 116835043
2-(5-bromo-1H-imidazol-2-yl)-2-(4-butan-2-ylphenyl)ethanamine (PubChem CID 116835043) has the molecular formula C15H20BrN3 and a molecular weight of 322.25 g/mol. Its IUPAC name is 2-(5-bromo-1H-imidazol-2-yl)-2-(4-butan-2-ylphenyl)ethanamine.
| Compound Name | 2-(5-bromo-1H-imidazol-2-yl)-2-(4-butan-2-ylphenyl)ethanamine |
|---|---|
| PubChem CID | 116835043 |
| Molecular Formula | C15H20BrN3 |
| Molecular Weight | 322.25 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 2-(5-bromo-1H-imidazol-2-yl)-2-(4-butan-2-ylphenyl)ethanamine |
| SMILES | CCC(C)c1ccc(C(CN)c2ncc(Br)[nH]2)cc1 |
| InChI | InChI=1S/C15H20BrN3/c1-3-10(2)11-4-6-12(7-5-11)13(8-17)15-18-9-14(16)19-15/h4-7,9-10,13H,3,8,17H2,1-2H3,(H,18,19) |
| InChIKey | OKQYHABURPJKBF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.25 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |