About (1-aminocyclopropyl)-(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)methanol
(1-aminocyclopropyl)-(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)methanol (PubChem CID 116836223) has the molecular formula C13H17NO3S
and a molecular weight of 267.35 g/mol. Its IUPAC name is (1-aminocyclopropyl)-(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)methanol.
Molecular Properties
| Compound Name | (1-aminocyclopropyl)-(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)methanol |
| PubChem CID | 116836223 |
| Molecular Formula | C13H17NO3S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | (1-aminocyclopropyl)-(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)methanol |
| SMILES | NC1(C(O)c2ccc3c(c2)CCCS3(=O)=O)CC1 |
| InChI | InChI=1S/C13H17NO3S/c14-13(5-6-13)12(15)10-3-4-11-9(8-10)2-1-7-18(11,16)17/h3-4,8,12,15H,1-2,5-7,14H2 |
| InChIKey | RRGLYJQAJMDTAY-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-aminocyclopropyl)-(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-aminocyclopropyl)-(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)methanol?
The IUPAC name of (1-aminocyclopropyl)-(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)methanol (CID 116836223) is (1-aminocyclopropyl)-(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)methanol.
What is the SMILES notation for (1-aminocyclopropyl)-(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)methanol?
The canonical SMILES for (1-aminocyclopropyl)-(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)methanol is NC1(C(O)c2ccc3c(c2)CCCS3(=O)=O)CC1.
What is the InChIKey of (1-aminocyclopropyl)-(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)methanol?
The InChIKey is RRGLYJQAJMDTAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO3S/c14-13(5-6-13)12(15)10-3-4-11-9(8-10)2-1-7-18(11,16)17/h3-4,8,12,15H,1-2,5-7,14H2.
What are the key properties of (1-aminocyclopropyl)-(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)methanol?
(1-aminocyclopropyl)-(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)methanol has a molecular weight of 267.35 g/mol, XLogP of 0.93, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-aminocyclopropyl)-(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)methanol is sourced from PubChem (CID 116836223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).