C20H20ClF6NO — CID 11683624
2-[3-chloro-4-[ethyl(3-phenylpropyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 11683624) has the molecular formula C20H20ClF6NO and a molecular weight of 439.83 g/mol. Its IUPAC name is 2-[3-chloro-4-[ethyl(3-phenylpropyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[3-chloro-4-[ethyl(3-phenylpropyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 11683624 |
| Molecular Formula | C20H20ClF6NO |
| Molecular Weight | 439.83 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | 2-[3-chloro-4-[ethyl(3-phenylpropyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CCN(CCCc1ccccc1)c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C20H20ClF6NO/c1-2-28(12-6-9-14-7-4-3-5-8-14)17-11-10-15(13-16(17)21)18(29,19(22,23)24)20(25,26)27/h3-5,7-8,10-11,13,29H,2,6,9,12H2,1H3 |
| InChIKey | MKFKDNQCQNLJEY-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.83 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|