C9H4F3NO2 — CID 116836453
1-(1,3-benzoxazol-6-yl)-2,2,2-trifluoroethanone (PubChem CID 116836453) has the molecular formula C9H4F3NO2 and a molecular weight of 215.13 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-6-yl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(1,3-benzoxazol-6-yl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 116836453 |
| Molecular Formula | C9H4F3NO2 |
| Molecular Weight | 215.13 g/mol |
| Exact Mass | 215.02 |
| IUPAC Name | 1-(1,3-benzoxazol-6-yl)-2,2,2-trifluoroethanone |
| SMILES | O=C(c1ccc2ncoc2c1)C(F)(F)F |
| InChI | InChI=1S/C9H4F3NO2/c10-9(11,12)8(14)5-1-2-6-7(3-5)15-4-13-6/h1-4H |
| InChIKey | SGSPDGHIYPPAEG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.13 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |