About 3-(6-methyl-1,3-benzodioxol-5-yl)imidazo[1,5-a]pyridine
3-(6-methyl-1,3-benzodioxol-5-yl)imidazo[1,5-a]pyridine (PubChem CID 116836554) has the molecular formula C15H12N2O2
and a molecular weight of 252.27 g/mol. Its IUPAC name is 3-(6-methyl-1,3-benzodioxol-5-yl)imidazo[1,5-a]pyridine.
Molecular Properties
| Compound Name | 3-(6-methyl-1,3-benzodioxol-5-yl)imidazo[1,5-a]pyridine |
| PubChem CID | 116836554 |
| Molecular Formula | C15H12N2O2 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 3-(6-methyl-1,3-benzodioxol-5-yl)imidazo[1,5-a]pyridine |
| SMILES | Cc1cc2c(cc1-c1ncc3ccccn13)OCO2 |
| InChI | InChI=1S/C15H12N2O2/c1-10-6-13-14(19-9-18-13)7-12(10)15-16-8-11-4-2-3-5-17(11)15/h2-8H,9H2,1H3 |
| InChIKey | CKWVZIQSWLYPOA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 35.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(6-methyl-1,3-benzodioxol-5-yl)imidazo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-methyl-1,3-benzodioxol-5-yl)imidazo[1,5-a]pyridine?
The IUPAC name of 3-(6-methyl-1,3-benzodioxol-5-yl)imidazo[1,5-a]pyridine (CID 116836554) is 3-(6-methyl-1,3-benzodioxol-5-yl)imidazo[1,5-a]pyridine.
What is the SMILES notation for 3-(6-methyl-1,3-benzodioxol-5-yl)imidazo[1,5-a]pyridine?
The canonical SMILES for 3-(6-methyl-1,3-benzodioxol-5-yl)imidazo[1,5-a]pyridine is Cc1cc2c(cc1-c1ncc3ccccn13)OCO2.
What is the InChIKey of 3-(6-methyl-1,3-benzodioxol-5-yl)imidazo[1,5-a]pyridine?
The InChIKey is CKWVZIQSWLYPOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O2/c1-10-6-13-14(19-9-18-13)7-12(10)15-16-8-11-4-2-3-5-17(11)15/h2-8H,9H2,1H3.
What are the key properties of 3-(6-methyl-1,3-benzodioxol-5-yl)imidazo[1,5-a]pyridine?
3-(6-methyl-1,3-benzodioxol-5-yl)imidazo[1,5-a]pyridine has a molecular weight of 252.27 g/mol, XLogP of 3.04, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-methyl-1,3-benzodioxol-5-yl)imidazo[1,5-a]pyridine is sourced from PubChem (CID 116836554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).