C12H12ClNO — CID 116837117
1-[(2-chloro-4-methoxyphenyl)methyl]cyclopropane-1-carbonitrile (PubChem CID 116837117) has the molecular formula C12H12ClNO and a molecular weight of 221.69 g/mol. Its IUPAC name is 1-[(2-chloro-4-methoxyphenyl)methyl]cyclopropane-1-carbonitrile.
| Compound Name | 1-[(2-chloro-4-methoxyphenyl)methyl]cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 116837117 |
| Molecular Formula | C12H12ClNO |
| Molecular Weight | 221.69 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 1-[(2-chloro-4-methoxyphenyl)methyl]cyclopropane-1-carbonitrile |
| SMILES | COc1ccc(CC2(C#N)CC2)c(Cl)c1 |
| InChI | InChI=1S/C12H12ClNO/c1-15-10-3-2-9(11(13)6-10)7-12(8-14)4-5-12/h2-3,6H,4-5,7H2,1H3 |
| InChIKey | DYIWWYHZWSDXNK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.69 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |