About 6-bromo-3-(4-ethylphenyl)-3,4-dihydro-2H-1,4-benzoxazine
6-bromo-3-(4-ethylphenyl)-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 116837282) has the molecular formula C16H16BrNO
and a molecular weight of 318.21 g/mol. Its IUPAC name is 6-bromo-3-(4-ethylphenyl)-3,4-dihydro-2H-1,4-benzoxazine.
Molecular Properties
| Compound Name | 6-bromo-3-(4-ethylphenyl)-3,4-dihydro-2H-1,4-benzoxazine |
| PubChem CID | 116837282 |
| Molecular Formula | C16H16BrNO |
| Molecular Weight | 318.21 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 6-bromo-3-(4-ethylphenyl)-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | CCc1ccc(C2COc3ccc(Br)cc3N2)cc1 |
| InChI | InChI=1S/C16H16BrNO/c1-2-11-3-5-12(6-4-11)15-10-19-16-8-7-13(17)9-14(16)18-15/h3-9,15,18H,2,10H2,1H3 |
| InChIKey | GDUQWIBXISNNEW-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.21 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromo-3-(4-ethylphenyl)-3,4-dihydro-2H-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3-(4-ethylphenyl)-3,4-dihydro-2H-1,4-benzoxazine?
The IUPAC name of 6-bromo-3-(4-ethylphenyl)-3,4-dihydro-2H-1,4-benzoxazine (CID 116837282) is 6-bromo-3-(4-ethylphenyl)-3,4-dihydro-2H-1,4-benzoxazine.
What is the SMILES notation for 6-bromo-3-(4-ethylphenyl)-3,4-dihydro-2H-1,4-benzoxazine?
The canonical SMILES for 6-bromo-3-(4-ethylphenyl)-3,4-dihydro-2H-1,4-benzoxazine is CCc1ccc(C2COc3ccc(Br)cc3N2)cc1.
What is the InChIKey of 6-bromo-3-(4-ethylphenyl)-3,4-dihydro-2H-1,4-benzoxazine?
The InChIKey is GDUQWIBXISNNEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16BrNO/c1-2-11-3-5-12(6-4-11)15-10-19-16-8-7-13(17)9-14(16)18-15/h3-9,15,18H,2,10H2,1H3.
What are the key properties of 6-bromo-3-(4-ethylphenyl)-3,4-dihydro-2H-1,4-benzoxazine?
6-bromo-3-(4-ethylphenyl)-3,4-dihydro-2H-1,4-benzoxazine has a molecular weight of 318.21 g/mol, XLogP of 4.56, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3-(4-ethylphenyl)-3,4-dihydro-2H-1,4-benzoxazine is sourced from PubChem (CID 116837282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).