About 5,7-dichloro-3-(4-iodophenyl)-3-methyl-1H-quinoline-2,4-dione
5,7-dichloro-3-(4-iodophenyl)-3-methyl-1H-quinoline-2,4-dione (PubChem CID 11683768) has the molecular formula C16H10Cl2INO2
and a molecular weight of 446.07 g/mol. Its IUPAC name is 5,7-dichloro-3-(4-iodophenyl)-3-methyl-1H-quinoline-2,4-dione.
Molecular Properties
| Compound Name | 5,7-dichloro-3-(4-iodophenyl)-3-methyl-1H-quinoline-2,4-dione |
| PubChem CID | 11683768 |
| Molecular Formula | C16H10Cl2INO2 |
| Molecular Weight | 446.07 g/mol |
| Exact Mass | 444.91 |
| IUPAC Name | 5,7-dichloro-3-(4-iodophenyl)-3-methyl-1H-quinoline-2,4-dione |
| SMILES | CC1(c2ccc(I)cc2)C(=O)Nc2cc(Cl)cc(Cl)c2C1=O |
| InChI | InChI=1S/C16H10Cl2INO2/c1-16(8-2-4-10(19)5-3-8)14(21)13-11(18)6-9(17)7-12(13)20-15(16)22/h2-7H,1H3,(H,20,22) |
| InChIKey | ICQDNANFHUWEGW-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.07 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5,7-dichloro-3-(4-iodophenyl)-3-methyl-1H-quinoline-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dichloro-3-(4-iodophenyl)-3-methyl-1H-quinoline-2,4-dione?
The IUPAC name of 5,7-dichloro-3-(4-iodophenyl)-3-methyl-1H-quinoline-2,4-dione (CID 11683768) is 5,7-dichloro-3-(4-iodophenyl)-3-methyl-1H-quinoline-2,4-dione.
What is the SMILES notation for 5,7-dichloro-3-(4-iodophenyl)-3-methyl-1H-quinoline-2,4-dione?
The canonical SMILES for 5,7-dichloro-3-(4-iodophenyl)-3-methyl-1H-quinoline-2,4-dione is CC1(c2ccc(I)cc2)C(=O)Nc2cc(Cl)cc(Cl)c2C1=O.
What is the InChIKey of 5,7-dichloro-3-(4-iodophenyl)-3-methyl-1H-quinoline-2,4-dione?
The InChIKey is ICQDNANFHUWEGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10Cl2INO2/c1-16(8-2-4-10(19)5-3-8)14(21)13-11(18)6-9(17)7-12(13)20-15(16)22/h2-7H,1H3,(H,20,22).
What are the key properties of 5,7-dichloro-3-(4-iodophenyl)-3-methyl-1H-quinoline-2,4-dione?
5,7-dichloro-3-(4-iodophenyl)-3-methyl-1H-quinoline-2,4-dione has a molecular weight of 446.07 g/mol, XLogP of 4.69, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dichloro-3-(4-iodophenyl)-3-methyl-1H-quinoline-2,4-dione is sourced from PubChem (CID 11683768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).