About 6-chloro-3-(1-methylpiperidin-4-yl)-3,4-dihydro-2H-1,4-benzoxazine
6-chloro-3-(1-methylpiperidin-4-yl)-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 116837716) has the molecular formula C14H19ClN2O
and a molecular weight of 266.77 g/mol. Its IUPAC name is 6-chloro-3-(1-methylpiperidin-4-yl)-3,4-dihydro-2H-1,4-benzoxazine.
Molecular Properties
| Compound Name | 6-chloro-3-(1-methylpiperidin-4-yl)-3,4-dihydro-2H-1,4-benzoxazine |
| PubChem CID | 116837716 |
| Molecular Formula | C14H19ClN2O |
| Molecular Weight | 266.77 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 6-chloro-3-(1-methylpiperidin-4-yl)-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | CN1CCC(C2COc3ccc(Cl)cc3N2)CC1 |
| InChI | InChI=1S/C14H19ClN2O/c1-17-6-4-10(5-7-17)13-9-18-14-3-2-11(15)8-12(14)16-13/h2-3,8,10,13,16H,4-7,9H2,1H3 |
| InChIKey | AVXYJJSPWWKIFP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.77 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-chloro-3-(1-methylpiperidin-4-yl)-3,4-dihydro-2H-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-(1-methylpiperidin-4-yl)-3,4-dihydro-2H-1,4-benzoxazine?
The IUPAC name of 6-chloro-3-(1-methylpiperidin-4-yl)-3,4-dihydro-2H-1,4-benzoxazine (CID 116837716) is 6-chloro-3-(1-methylpiperidin-4-yl)-3,4-dihydro-2H-1,4-benzoxazine.
What is the SMILES notation for 6-chloro-3-(1-methylpiperidin-4-yl)-3,4-dihydro-2H-1,4-benzoxazine?
The canonical SMILES for 6-chloro-3-(1-methylpiperidin-4-yl)-3,4-dihydro-2H-1,4-benzoxazine is CN1CCC(C2COc3ccc(Cl)cc3N2)CC1.
What is the InChIKey of 6-chloro-3-(1-methylpiperidin-4-yl)-3,4-dihydro-2H-1,4-benzoxazine?
The InChIKey is AVXYJJSPWWKIFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19ClN2O/c1-17-6-4-10(5-7-17)13-9-18-14-3-2-11(15)8-12(14)16-13/h2-3,8,10,13,16H,4-7,9H2,1H3.
What are the key properties of 6-chloro-3-(1-methylpiperidin-4-yl)-3,4-dihydro-2H-1,4-benzoxazine?
6-chloro-3-(1-methylpiperidin-4-yl)-3,4-dihydro-2H-1,4-benzoxazine has a molecular weight of 266.77 g/mol, XLogP of 2.85, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-(1-methylpiperidin-4-yl)-3,4-dihydro-2H-1,4-benzoxazine is sourced from PubChem (CID 116837716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).